C24H32Cl2O4 — CID 155391255
6-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]hexanoic acid (PubChem CID 155391255) has the molecular formula C24H32Cl2O4 and a molecular weight of 455.42 g/mol. Its IUPAC name is 6-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]hexanoic acid.
| Compound Name | 6-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]hexanoic acid |
|---|---|
| PubChem CID | 155391255 |
| Molecular Formula | C24H32Cl2O4 |
| Molecular Weight | 455.42 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 6-[(2-butyl-6,7-dichloro-2-cyclopentyl-1-oxo-3H-inden-5-yl)oxy]hexanoic acid |
| SMILES | CCCCC1(C2CCCC2)Cc2cc(OCCCCCC(=O)O)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C24H32Cl2O4/c1-2-3-12-24(17-9-6-7-10-17)15-16-14-18(21(25)22(26)20(16)23(24)29)30-13-8-4-5-11-19(27)28/h14,17H,2-13,15H2,1H3,(H,27,28) |
| InChIKey | FIKZJKNXSONXIQ-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.42 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|