C22H28F2O3 — CID 155741407
4-[(2-butyl-2-cyclopentyl-6,7-difluoro-1-oxo-3H-inden-5-yl)oxy]butanal (PubChem CID 155741407) has the molecular formula C22H28F2O3 and a molecular weight of 378.46 g/mol. Its IUPAC name is 4-[(2-butyl-2-cyclopentyl-6,7-difluoro-1-oxo-3H-inden-5-yl)oxy]butanal.
| Compound Name | 4-[(2-butyl-2-cyclopentyl-6,7-difluoro-1-oxo-3H-inden-5-yl)oxy]butanal |
|---|---|
| PubChem CID | 155741407 |
| Molecular Formula | C22H28F2O3 |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 4-[(2-butyl-2-cyclopentyl-6,7-difluoro-1-oxo-3H-inden-5-yl)oxy]butanal |
| SMILES | CCCCC1(C2CCCC2)Cc2cc(OCCCC=O)c(F)c(F)c2C1=O |
| InChI | InChI=1S/C22H28F2O3/c1-2-3-10-22(16-8-4-5-9-16)14-15-13-17(27-12-7-6-11-25)19(23)20(24)18(15)21(22)26/h11,13,16H,2-10,12,14H2,1H3 |
| InChIKey | ZANBHWJDQYCIBW-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|