C21H29NO3 — CID 54461729
2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione (PubChem CID 54461729) has the molecular formula C21H29NO3 and a molecular weight of 343.47 g/mol. Its IUPAC name is 2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione.
| Compound Name | 2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 54461729 |
| Molecular Formula | C21H29NO3 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 2-(N-ethoxy-C-propylcarbonimidoyl)-5-(2,4,6-trimethylphenyl)cyclohexane-1,3-dione |
| SMILES | CCCC(=NOCC)C1C(=O)CC(c2c(C)cc(C)cc2C)CC1=O |
| InChI | InChI=1S/C21H29NO3/c1-6-8-17(22-25-7-2)21-18(23)11-16(12-19(21)24)20-14(4)9-13(3)10-15(20)5/h9-10,16,21H,6-8,11-12H2,1-5H3 |
| InChIKey | XCBPWLRIVIGZBK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|