C9H14N2O2 — CID 54462773
1-piperidin-4-ylpyrrole-2,5-diol (PubChem CID 54462773) has the molecular formula C9H14N2O2 and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-piperidin-4-ylpyrrole-2,5-diol.
| Compound Name | 1-piperidin-4-ylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 54462773 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | 1-piperidin-4-ylpyrrole-2,5-diol |
| SMILES | Oc1ccc(O)n1C1CCNCC1 |
| InChI | InChI=1S/C9H14N2O2/c12-8-1-2-9(13)11(8)7-3-5-10-6-4-7/h1-2,7,10,12-13H,3-6H2 |
| InChIKey | XCTGODZUCLHSIM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |