C11H8N2O — CID 54464518
2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one (PubChem CID 54464518) has the molecular formula C11H8N2O and a molecular weight of 184.20 g/mol. Its IUPAC name is 2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one.
| Compound Name | 2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one |
|---|---|
| PubChem CID | 54464518 |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.20 g/mol |
| Exact Mass | 184.06 |
| IUPAC Name | 2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one |
| SMILES | O=c1cc2cccc3c2c([nH]1)NC=C3 |
| InChI | InChI=1S/C11H8N2O/c14-9-6-8-3-1-2-7-4-5-12-11(13-9)10(7)8/h1-6H,(H2,12,13,14) |
| InChIKey | XDXKPENTYWSAMV-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |