C12H10N2O — CID 91141309
8-methyl-2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one (PubChem CID 91141309) has the molecular formula C12H10N2O and a molecular weight of 198.22 g/mol. Its IUPAC name is 8-methyl-2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one.
| Compound Name | 8-methyl-2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one |
|---|---|
| PubChem CID | 91141309 |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 8-methyl-2,12-diazatricyclo[7.3.1.05,13]trideca-1(13),4,6,8,10-pentaen-3-one |
| SMILES | Cc1ccc2cc(=O)[nH]c3c2c1C=CN3 |
| InChI | InChI=1S/C12H10N2O/c1-7-2-3-8-6-10(15)14-12-11(8)9(7)4-5-13-12/h2-6H,1H3,(H2,13,14,15) |
| InChIKey | XQWOTVVMOVUBNH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |