C20H22N2O5 — CID 54470383
benzyl (2R)-2-[[6-(acetyloxymethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate (PubChem CID 54470383) has the molecular formula C20H22N2O5 and a molecular weight of 370.41 g/mol. Its IUPAC name is benzyl (2R)-2-[[6-(acetyloxymethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate.
| Compound Name | benzyl (2R)-2-[[6-(acetyloxymethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 54470383 |
| Molecular Formula | C20H22N2O5 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | benzyl (2R)-2-[[6-(acetyloxymethyl)-3-pyridinyl]oxymethyl]azetidine-1-carboxylate |
| SMILES | CC(=O)OCc1ccc(OC[C@H]2CCN2C(=O)OCc2ccccc2)cn1 |
| InChI | InChI=1S/C20H22N2O5/c1-15(23)25-13-17-7-8-19(11-21-17)26-14-18-9-10-22(18)20(24)27-12-16-5-3-2-4-6-16/h2-8,11,18H,9-10,12-14H2,1H3/t18-/m1/s1 |
| InChIKey | XHXRRLZUYLGOMZ-GOSISDBHSA-N |
| XLogP | 2.93 |
| TPSA | 77.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |