C12H15NO5 — CID 66630587
[5-(1,3-dioxolan-2-ylmethoxy)-2-pyridinyl]methyl acetate (PubChem CID 66630587) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is [5-(1,3-dioxolan-2-ylmethoxy)-2-pyridinyl]methyl acetate.
| Compound Name | [5-(1,3-dioxolan-2-ylmethoxy)-2-pyridinyl]methyl acetate |
|---|---|
| PubChem CID | 66630587 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | [5-(1,3-dioxolan-2-ylmethoxy)-2-pyridinyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(OCC2OCCO2)cn1 |
| InChI | InChI=1S/C12H15NO5/c1-9(14)17-7-10-2-3-11(6-13-10)18-8-12-15-4-5-16-12/h2-3,6,12H,4-5,7-8H2,1H3 |
| InChIKey | LTMCJECTSBCXBL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |