C31H43N5O6 — CID 54473874
2-[11-[2-[benzyl-[2-(tert-butylamino)-2-oxoethyl]amino]-1-hydroxyethyl]-6,9-dioxo-2-oxa-7,10-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-8-yl]acetamide (PubChem CID 54473874) has the molecular formula C31H43N5O6 and a molecular weight of 581.71 g/mol. Its IUPAC name is 2-[11-[2-[benzyl-[2-(tert-butylamino)-2-oxoethyl]amino]-1-hydroxyethyl]-6,9-dioxo-2-oxa-7,10-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-8-yl]acetamide.
| Compound Name | 2-[11-[2-[benzyl-[2-(tert-butylamino)-2-oxoethyl]amino]-1-hydroxyethyl]-6,9-dioxo-2-oxa-7,10-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-8-yl]acetamide |
|---|---|
| PubChem CID | 54473874 |
| Molecular Formula | C31H43N5O6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | 2-[11-[2-[benzyl-[2-(tert-butylamino)-2-oxoethyl]amino]-1-hydroxyethyl]-6,9-dioxo-2-oxa-7,10-diazabicyclo[11.2.2]heptadeca-1(15),13,16-trien-8-yl]acetamide |
| SMILES | CC(C)(C)NC(=O)CN(Cc1ccccc1)CC(O)C1Cc2ccc(cc2)OCCCC(=O)NC(CC(N)=O)C(=O)N1 |
| InChI | InChI=1S/C31H43N5O6/c1-31(2,3)35-29(40)20-36(18-22-8-5-4-6-9-22)19-26(37)24-16-21-11-13-23(14-12-21)42-15-7-10-28(39)33-25(17-27(32)38)30(41)34-24/h4-6,8-9,11-14,24-26,37H,7,10,15-20H2,1-3H3,(H2,32,38)(H,33,39)(H,34,41)(H,35,40) |
| InChIKey | XKESIIFKQLAQEQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |