C29H40FN3O4 — CID 71055771
(12S)-12-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-propan-2-yl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 71055771) has the molecular formula C29H40FN3O4 and a molecular weight of 513.65 g/mol. Its IUPAC name is (12S)-12-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-propan-2-yl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | (12S)-12-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-propan-2-yl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 71055771 |
| Molecular Formula | C29H40FN3O4 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.30 |
| IUPAC Name | (12S)-12-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-propan-2-yl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | CCc1cccc(CNC[C@@H](O)[C@@H]2Cc3cc(F)cc(c3)OCCCCC(=O)NC(C(C)C)C(=O)N2)c1 |
| InChI | InChI=1S/C29H40FN3O4/c1-4-20-8-7-9-21(12-20)17-31-18-26(34)25-15-22-13-23(30)16-24(14-22)37-11-6-5-10-27(35)33-28(19(2)3)29(36)32-25/h7-9,12-14,16,19,25-26,28,31,34H,4-6,10-11,15,17-18H2,1-3H3,(H,32,36)(H,33,35)/t25-,26+,28?/m0/s1 |
| InChIKey | WQKQHUZVMWKSEV-VEPNZUSMSA-N |
| XLogP | 3.27 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |