C30H42FN3O4 — CID 58650906
(13S)-13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-7-propyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 58650906) has the molecular formula C30H42FN3O4 and a molecular weight of 527.68 g/mol. Its IUPAC name is (13S)-13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-7-propyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | (13S)-13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-7-propyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 58650906 |
| Molecular Formula | C30H42FN3O4 |
| Molecular Weight | 527.68 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | (13S)-13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-7-propyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | CCCN1CCCCOc2cc(F)cc(c2)C[C@@H]([C@H](O)CNCc2cccc(CC)c2)NC(=O)CCC1=O |
| InChI | InChI=1S/C30H42FN3O4/c1-3-12-34-13-5-6-14-38-26-17-24(16-25(31)19-26)18-27(33-29(36)10-11-30(34)37)28(35)21-32-20-23-9-7-8-22(4-2)15-23/h7-9,15-17,19,27-28,32,35H,3-6,10-14,18,20-21H2,1-2H3,(H,33,36)/t27-,28+/m0/s1 |
| InChIKey | WFDOMFPKIIWXSE-WUFINQPMSA-N |
| XLogP | 3.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.68 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |