C22H33FN2O5 — CID 58584357
(14S)-14-[(1S)-1,2-dihydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione (PubChem CID 58584357) has the molecular formula C22H33FN2O5 and a molecular weight of 424.51 g/mol. Its IUPAC name is (14S)-14-[(1S)-1,2-dihydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione.
| Compound Name | (14S)-14-[(1S)-1,2-dihydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
|---|---|
| PubChem CID | 58584357 |
| Molecular Formula | C22H33FN2O5 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (14S)-14-[(1S)-1,2-dihydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
| SMILES | CCCN1CCCCOc2cc(F)cc(c2)C[C@@H]([C@H](O)CO)NC(=O)CCCC1=O |
| InChI | InChI=1S/C22H33FN2O5/c1-2-8-25-9-3-4-10-30-18-12-16(11-17(23)14-18)13-19(20(27)15-26)24-21(28)6-5-7-22(25)29/h11-12,14,19-20,26-27H,2-10,13,15H2,1H3,(H,24,28)/t19-,20+/m0/s1 |
| InChIKey | GZRYYBZCXHVPTG-VQTJNVASSA-N |
| XLogP | 1.79 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |