C30H37F4N3O4 — CID 69310505
18-fluoro-14-[1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),4,16(20),17-tetraene-8,12-dione (PubChem CID 69310505) has the molecular formula C30H37F4N3O4 and a molecular weight of 579.64 g/mol. Its IUPAC name is 18-fluoro-14-[1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),4,16(20),17-tetraene-8,12-dione.
| Compound Name | 18-fluoro-14-[1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),4,16(20),17-tetraene-8,12-dione |
|---|---|
| PubChem CID | 69310505 |
| Molecular Formula | C30H37F4N3O4 |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.27 |
| IUPAC Name | 18-fluoro-14-[1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),4,16(20),17-tetraene-8,12-dione |
| SMILES | CCCN1CC=CCOc2cc(F)cc(c2)CC(C(O)CNCc2cccc(C(F)(F)F)c2)NC(=O)CCCC1=O |
| InChI | InChI=1S/C30H37F4N3O4/c1-2-11-37-12-3-4-13-41-25-16-22(15-24(31)18-25)17-26(36-28(39)9-6-10-29(37)40)27(38)20-35-19-21-7-5-8-23(14-21)30(32,33)34/h3-5,7-8,14-16,18,26-27,35,38H,2,6,9-13,17,19-20H2,1H3,(H,36,39) |
| InChIKey | LGCOAGCCSVLCPM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|