C28H35F4N3O4S — CID 89231616
(12S)-16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-(2-sulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 89231616) has the molecular formula C28H35F4N3O4S and a molecular weight of 585.66 g/mol. Its IUPAC name is (12S)-16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-(2-sulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | (12S)-16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-(2-sulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 89231616 |
| Molecular Formula | C28H35F4N3O4S |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | (12S)-16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-(2-sulfanylethyl)-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | CN1C(=O)CCCCOc2cc(F)cc(c2)C[C@@H]([C@H](O)CNCc2cccc(C(F)(F)F)c2)NC(=O)C1CCS |
| InChI | InChI=1S/C28H35F4N3O4S/c1-35-24(8-10-40)27(38)34-23(25(36)17-33-16-18-5-4-6-20(11-18)28(30,31)32)14-19-12-21(29)15-22(13-19)39-9-3-2-7-26(35)37/h4-6,11-13,15,23-25,33,36,40H,2-3,7-10,14,16-17H2,1H3,(H,34,38)/t23-,24?,25+/m0/s1 |
| InChIKey | BSFXKPYEMAMHHY-QNRWSGHRSA-N |
| XLogP | 3.73 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|