C30H38FN3O4 — CID 10279778
12-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 10279778) has the molecular formula C30H38FN3O4 and a molecular weight of 523.65 g/mol. Its IUPAC name is 12-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | 12-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 10279778 |
| Molecular Formula | C30H38FN3O4 |
| Molecular Weight | 523.65 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 12-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-16-fluoro-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | C#CCC1C(=O)NC(C(O)CNCc2cccc(CC)c2)Cc2cc(F)cc(c2)OCCCCC(=O)N1C |
| InChI | InChI=1S/C30H38FN3O4/c1-4-9-27-30(37)33-26(28(35)20-32-19-22-11-8-10-21(5-2)14-22)17-23-15-24(31)18-25(16-23)38-13-7-6-12-29(36)34(27)3/h1,8,10-11,14-16,18,26-28,32,35H,5-7,9,12-13,17,19-20H2,2-3H3,(H,33,37) |
| InChIKey | WUWQXZWOMKJTGH-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|