C27H36FN3O4 — CID 71055720
13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 71055720) has the molecular formula C27H36FN3O4 and a molecular weight of 485.60 g/mol. Its IUPAC name is 13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | 13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 71055720 |
| Molecular Formula | C27H36FN3O4 |
| Molecular Weight | 485.60 g/mol |
| Exact Mass | 485.27 |
| IUPAC Name | 13-[(1R)-2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | CCc1cccc(CNC[C@@H](O)C2Cc3cc(F)cc(c3)OCCCCCC(=O)NCC(=O)N2)c1 |
| InChI | InChI=1S/C27H36FN3O4/c1-2-19-7-6-8-20(11-19)16-29-17-25(32)24-14-21-12-22(28)15-23(13-21)35-10-5-3-4-9-26(33)30-18-27(34)31-24/h6-8,11-13,15,24-25,29,32H,2-5,9-10,14,16-18H2,1H3,(H,30,33)(H,31,34)/t24?,25-/m1/s1 |
| InChIKey | NWGGJGGVYSBLOP-WUBHUQEYSA-N |
| XLogP | 2.64 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |