C26H30FN3O4 — CID 10183483
12-[2-[(3-ethynylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 10183483) has the molecular formula C26H30FN3O4 and a molecular weight of 467.54 g/mol. Its IUPAC name is 12-[2-[(3-ethynylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | 12-[2-[(3-ethynylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 10183483 |
| Molecular Formula | C26H30FN3O4 |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | 12-[2-[(3-ethynylphenyl)methylamino]-1-hydroxyethyl]-17-fluoro-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | C#Cc1cccc(CNCC(O)C2Cc3ccc(F)c(c3)OCCCCC(=O)NCC(=O)N2)c1 |
| InChI | InChI=1S/C26H30FN3O4/c1-2-18-6-5-7-20(12-18)15-28-16-23(31)22-13-19-9-10-21(27)24(14-19)34-11-4-3-8-25(32)29-17-26(33)30-22/h1,5-7,9-10,12,14,22-23,28,31H,3-4,8,11,13,15-17H2,(H,29,32)(H,30,33) |
| InChIKey | IEFUSHPRPIDKLW-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|