C33H42FN3O4 — CID 58651049
(14S)-14-[(1R)-2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione (PubChem CID 58651049) has the molecular formula C33H42FN3O4 and a molecular weight of 563.71 g/mol. Its IUPAC name is (14S)-14-[(1R)-2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione.
| Compound Name | (14S)-14-[(1R)-2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
|---|---|
| PubChem CID | 58651049 |
| Molecular Formula | C33H42FN3O4 |
| Molecular Weight | 563.71 g/mol |
| Exact Mass | 563.32 |
| IUPAC Name | (14S)-14-[(1R)-2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-7-propyl-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
| SMILES | C#Cc1cccc(C2(NC[C@@H](O)[C@@H]3Cc4cc(F)cc(c4)OCCCCN(CCC)C(=O)CCCC(=O)N3)CC2)c1 |
| InChI | InChI=1S/C33H42FN3O4/c1-3-15-37-16-5-6-17-41-28-20-25(19-27(34)22-28)21-29(36-31(39)11-8-12-32(37)40)30(38)23-35-33(13-14-33)26-10-7-9-24(4-2)18-26/h2,7,9-10,18-20,22,29-30,35,38H,3,5-6,8,11-17,21,23H2,1H3,(H,36,39)/t29-,30+/m0/s1 |
| InChIKey | JESUQTPUPFEYIY-XZWHSSHBSA-N |
| XLogP | 4.06 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.71 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|