C29H34FN3O4 — CID 10279041
13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 10279041) has the molecular formula C29H34FN3O4 and a molecular weight of 507.61 g/mol. Its IUPAC name is 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 10279041 |
| Molecular Formula | C29H34FN3O4 |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | C#Cc1cccc(C2(NCC(O)C3Cc4cc(F)cc(c4)OCCCCCC(=O)NCC(=O)N3)CC2)c1 |
| InChI | InChI=1S/C29H34FN3O4/c1-2-20-7-6-8-22(13-20)29(10-11-29)32-18-26(34)25-16-21-14-23(30)17-24(15-21)37-12-5-3-4-9-27(35)31-19-28(36)33-25/h1,6-8,13-15,17,25-26,32,34H,3-5,9-12,16,18-19H2,(H,31,35)(H,33,36) |
| InChIKey | MXUVPGFPEJQVNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|