C33H40FN3O4 — CID 163595430
(3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione (PubChem CID 163595430) has the molecular formula C33H40FN3O4 and a molecular weight of 561.70 g/mol. Its IUPAC name is (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione.
| Compound Name | (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione |
|---|---|
| PubChem CID | 163595430 |
| Molecular Formula | C33H40FN3O4 |
| Molecular Weight | 561.70 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | (3S)-3-[(1R)-2-[[1-(3-ethylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-18-fluoro-6-prop-2-ynyl-15-oxa-4,10-diazatricyclo[14.3.1.06,8]icosa-1(20),16,18-triene-5,9-dione |
| SMILES | C#CCC12CC1C(=O)NCCCCOc1cc(F)cc(c1)C[C@@H]([C@H](O)CNC1(c3cccc(CC)c3)CC1)NC2=O |
| InChI | InChI=1S/C33H40FN3O4/c1-3-10-32-20-27(32)30(39)35-13-5-6-14-41-26-17-23(16-25(34)19-26)18-28(37-31(32)40)29(38)21-36-33(11-12-33)24-9-7-8-22(4-2)15-24/h1,7-9,15-17,19,27-29,36,38H,4-6,10-14,18,20-21H2,2H3,(H,35,39)(H,37,40)/t27?,28-,29+,32?/m0/s1 |
| InChIKey | GTABVHIDDYSPFY-ZTESRENESA-N |
| XLogP | 3.37 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|