C30H42FN3O5 — CID 10119794
14-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-18-fluoro-11-(methoxymethyl)-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione (PubChem CID 10119794) has the molecular formula C30H42FN3O5 and a molecular weight of 543.68 g/mol. Its IUPAC name is 14-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-18-fluoro-11-(methoxymethyl)-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione.
| Compound Name | 14-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-18-fluoro-11-(methoxymethyl)-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
|---|---|
| PubChem CID | 10119794 |
| Molecular Formula | C30H42FN3O5 |
| Molecular Weight | 543.68 g/mol |
| Exact Mass | 543.31 |
| IUPAC Name | 14-[2-[(3-ethylphenyl)methylamino]-1-hydroxyethyl]-18-fluoro-11-(methoxymethyl)-2-oxa-7,13-diazabicyclo[14.3.1]icosa-1(19),16(20),17-triene-8,12-dione |
| SMILES | CCc1cccc(CNCC(O)C2Cc3cc(F)cc(c3)OCCCCNC(=O)CCC(COC)C(=O)N2)c1 |
| InChI | InChI=1S/C30H42FN3O5/c1-3-21-7-6-8-22(13-21)18-32-19-28(35)27-16-23-14-25(31)17-26(15-23)39-12-5-4-11-33-29(36)10-9-24(20-38-2)30(37)34-27/h6-8,13-15,17,24,27-28,32,35H,3-5,9-12,16,18-20H2,1-2H3,(H,33,36)(H,34,37) |
| InChIKey | GJQIRWVSKCYYRK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |