C30H43N3O4 — CID 67375228
(10R,13S)-13-[(1R)-2-[(3-tert-butylphenyl)methylamino]-1-hydroxyethyl]-10-methyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 67375228) has the molecular formula C30H43N3O4 and a molecular weight of 509.69 g/mol. Its IUPAC name is (10R,13S)-13-[(1R)-2-[(3-tert-butylphenyl)methylamino]-1-hydroxyethyl]-10-methyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | (10R,13S)-13-[(1R)-2-[(3-tert-butylphenyl)methylamino]-1-hydroxyethyl]-10-methyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 67375228 |
| Molecular Formula | C30H43N3O4 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.33 |
| IUPAC Name | (10R,13S)-13-[(1R)-2-[(3-tert-butylphenyl)methylamino]-1-hydroxyethyl]-10-methyl-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | C[C@@H]1CC(=O)NCCCCOc2cccc(c2)C[C@@H]([C@H](O)CNCc2cccc(C(C)(C)C)c2)NC1=O |
| InChI | InChI=1S/C30H43N3O4/c1-21-15-28(35)32-13-5-6-14-37-25-12-8-9-22(17-25)18-26(33-29(21)36)27(34)20-31-19-23-10-7-11-24(16-23)30(2,3)4/h7-12,16-17,21,26-27,31,34H,5-6,13-15,18-20H2,1-4H3,(H,32,35)(H,33,36)/t21-,26+,27-/m1/s1 |
| InChIKey | BERWEADBUJLVLA-COFKYPDJSA-N |
| XLogP | 3.48 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |