C29H33F4N3O4 — CID 162578658
16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione (PubChem CID 162578658) has the molecular formula C29H33F4N3O4 and a molecular weight of 563.59 g/mol. Its IUPAC name is 16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione.
| Compound Name | 16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione |
|---|---|
| PubChem CID | 162578658 |
| Molecular Formula | C29H33F4N3O4 |
| Molecular Weight | 563.59 g/mol |
| Exact Mass | 563.24 |
| IUPAC Name | 16-fluoro-12-[(1R)-1-hydroxy-2-[[3-(trifluoromethyl)phenyl]methylamino]ethyl]-8-methyl-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.2.2]octadeca-1(16),14,17-triene-7,10-dione |
| SMILES | C#CCC1C(=O)NC([C@H](O)CNCc2cccc(C(F)(F)F)c2)Cc2ccc(c(F)c2)OCCCCC(=O)N1C |
| InChI | InChI=1S/C29H33F4N3O4/c1-3-7-24-28(39)35-23(25(37)18-34-17-20-8-6-9-21(14-20)29(31,32)33)16-19-11-12-26(22(30)15-19)40-13-5-4-10-27(38)36(24)2/h1,6,8-9,11-12,14-15,23-25,34,37H,4-5,7,10,13,16-18H2,2H3,(H,35,39)/t23?,24?,25-/m1/s1 |
| InChIKey | AZPDCOWSMNFTGU-DDJHWDJXSA-N |
| XLogP | 3.44 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|