C29H37FN4O4 — CID 22272358
13-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-17-fluoro-10-prop-2-ynyl-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 22272358) has the molecular formula C29H37FN4O4 and a molecular weight of 524.64 g/mol. Its IUPAC name is 13-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-17-fluoro-10-prop-2-ynyl-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | 13-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-17-fluoro-10-prop-2-ynyl-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 22272358 |
| Molecular Formula | C29H37FN4O4 |
| Molecular Weight | 524.64 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 13-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-17-fluoro-10-prop-2-ynyl-2-oxa-9,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | C#CCC1NC(=O)CCCCCOc2cc(F)cc(c2)CC(C(O)CNCc2cncc(CC)c2)NC1=O |
| InChI | InChI=1S/C29H37FN4O4/c1-3-8-25-29(37)34-26(27(35)19-32-18-22-11-20(4-2)16-31-17-22)14-21-12-23(30)15-24(13-21)38-10-7-5-6-9-28(36)33-25/h1,11-13,15-17,25-27,32,35H,4-10,14,18-19H2,2H3,(H,33,36)(H,34,37) |
| InChIKey | YQHXDAGPWVNCNZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.64 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|