C28H35FN4O4 — CID 22272348
12-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione (PubChem CID 22272348) has the molecular formula C28H35FN4O4 and a molecular weight of 510.61 g/mol. Its IUPAC name is 12-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione.
| Compound Name | 12-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
|---|---|
| PubChem CID | 22272348 |
| Molecular Formula | C28H35FN4O4 |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 12-[2-[(5-ethyl-3-pyridinyl)methylamino]-1-hydroxyethyl]-16-fluoro-9-prop-2-ynyl-2-oxa-8,11-diazabicyclo[12.3.1]octadeca-1(17),14(18),15-triene-7,10-dione |
| SMILES | C#CCC1NC(=O)CCCCOc2cc(F)cc(c2)CC(C(O)CNCc2cncc(CC)c2)NC1=O |
| InChI | InChI=1S/C28H35FN4O4/c1-3-7-24-28(36)33-25(26(34)18-31-17-21-10-19(4-2)15-30-16-21)13-20-11-22(29)14-23(12-20)37-9-6-5-8-27(35)32-24/h1,10-12,14-16,24-26,31,34H,4-9,13,17-18H2,2H3,(H,32,35)(H,33,36) |
| InChIKey | YGSTZMOZVKGWIC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|