C31H38FN3O5 — CID 22046547
13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-4-(methoxymethyl)-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione (PubChem CID 22046547) has the molecular formula C31H38FN3O5 and a molecular weight of 551.66 g/mol. Its IUPAC name is 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-4-(methoxymethyl)-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione.
| Compound Name | 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-4-(methoxymethyl)-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
|---|---|
| PubChem CID | 22046547 |
| Molecular Formula | C31H38FN3O5 |
| Molecular Weight | 551.66 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | 13-[2-[[1-(3-ethynylphenyl)cyclopropyl]amino]-1-hydroxyethyl]-17-fluoro-4-(methoxymethyl)-2-oxa-7,12-diazabicyclo[13.3.1]nonadeca-1(18),15(19),16-triene-8,11-dione |
| SMILES | C#Cc1cccc(C2(NCC(O)C3Cc4cc(F)cc(c4)OCC(COC)CCNC(=O)CCC(=O)N3)CC2)c1 |
| InChI | InChI=1S/C31H38FN3O5/c1-3-21-5-4-6-24(13-21)31(10-11-31)34-18-28(36)27-16-23-14-25(32)17-26(15-23)40-20-22(19-39-2)9-12-33-29(37)7-8-30(38)35-27/h1,4-6,13-15,17,22,27-28,34,36H,7-12,16,18-20H2,2H3,(H,33,37)(H,35,38) |
| InChIKey | LPENDBVUDSIKKY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|