C22H28N2O5 — CID 54475582
tert-butyl 4-hydroxy-3-(2-oxo-4-phenylmethoxy-1-pyridinyl)piperidine-1-carboxylate (PubChem CID 54475582) has the molecular formula C22H28N2O5 and a molecular weight of 400.48 g/mol. Its IUPAC name is tert-butyl 4-hydroxy-3-(2-oxo-4-phenylmethoxy-1-pyridinyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-hydroxy-3-(2-oxo-4-phenylmethoxy-1-pyridinyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 54475582 |
| Molecular Formula | C22H28N2O5 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | tert-butyl 4-hydroxy-3-(2-oxo-4-phenylmethoxy-1-pyridinyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)C(n2ccc(OCc3ccccc3)cc2=O)C1 |
| InChI | InChI=1S/C22H28N2O5/c1-22(2,3)29-21(27)23-11-10-19(25)18(14-23)24-12-9-17(13-20(24)26)28-15-16-7-5-4-6-8-16/h4-9,12-13,18-19,25H,10-11,14-15H2,1-3H3 |
| InChIKey | XLIJHVCLGCALIK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |