C25H34N2O7 — CID 57132642
tert-butyl [4-hydroxy-3-[2-oxo-4-(3-phenylmethoxypropoxy)-1-pyridinyl]piperidin-1-yl] carbonate (PubChem CID 57132642) has the molecular formula C25H34N2O7 and a molecular weight of 474.55 g/mol. Its IUPAC name is tert-butyl [4-hydroxy-3-[2-oxo-4-(3-phenylmethoxypropoxy)-1-pyridinyl]piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [4-hydroxy-3-[2-oxo-4-(3-phenylmethoxypropoxy)-1-pyridinyl]piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 57132642 |
| Molecular Formula | C25H34N2O7 |
| Molecular Weight | 474.55 g/mol |
| Exact Mass | 474.24 |
| IUPAC Name | tert-butyl [4-hydroxy-3-[2-oxo-4-(3-phenylmethoxypropoxy)-1-pyridinyl]piperidin-1-yl] carbonate |
| SMILES | CC(C)(C)OC(=O)ON1CCC(O)C(n2ccc(OCCCOCc3ccccc3)cc2=O)C1 |
| InChI | InChI=1S/C25H34N2O7/c1-25(2,3)33-24(30)34-26-12-11-22(28)21(17-26)27-13-10-20(16-23(27)29)32-15-7-14-31-18-19-8-5-4-6-9-19/h4-6,8-10,13,16,21-22,28H,7,11-12,14-15,17-18H2,1-3H3 |
| InChIKey | FYRWOWKVWYDPNZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.55 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|