C37H44N2O8 — CID 57057396
tert-butyl [4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(2-oxo-1H-quinolin-7-yl)methoxy]piperidin-1-yl] carbonate (PubChem CID 57057396) has the molecular formula C37H44N2O8 and a molecular weight of 644.77 g/mol. Its IUPAC name is tert-butyl [4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(2-oxo-1H-quinolin-7-yl)methoxy]piperidin-1-yl] carbonate.
| Compound Name | tert-butyl [4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(2-oxo-1H-quinolin-7-yl)methoxy]piperidin-1-yl] carbonate |
|---|---|
| PubChem CID | 57057396 |
| Molecular Formula | C37H44N2O8 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.31 |
| IUPAC Name | tert-butyl [4-[4-[3-[(2-methoxyphenyl)methoxy]propoxy]phenyl]-3-[(2-oxo-1H-quinolin-7-yl)methoxy]piperidin-1-yl] carbonate |
| SMILES | COc1ccccc1COCCCOc1ccc(C2CCN(OC(=O)OC(C)(C)C)CC2OCc2ccc3ccc(=O)[nH]c3c2)cc1 |
| InChI | InChI=1S/C37H44N2O8/c1-37(2,3)46-36(41)47-39-19-18-31(34(23-39)45-24-26-10-11-28-14-17-35(40)38-32(28)22-26)27-12-15-30(16-13-27)44-21-7-20-43-25-29-8-5-6-9-33(29)42-4/h5-6,8-17,22,31,34H,7,18-21,23-25H2,1-4H3,(H,38,40) |
| InChIKey | HJQGKUCYZBWWTF-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|