C40H51N5O11 — CID 56985613
[(3R,5S)-3,5-bis[(4,5-dimethoxypyrimidin-2-yl)oxymethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-1-yl] tert-butyl carbonate (PubChem CID 56985613) has the molecular formula C40H51N5O11 and a molecular weight of 777.87 g/mol. Its IUPAC name is [(3R,5S)-3,5-bis[(4,5-dimethoxypyrimidin-2-yl)oxymethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-1-yl] tert-butyl carbonate.
| Compound Name | [(3R,5S)-3,5-bis[(4,5-dimethoxypyrimidin-2-yl)oxymethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-1-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 56985613 |
| Molecular Formula | C40H51N5O11 |
| Molecular Weight | 777.87 g/mol |
| Exact Mass | 777.36 |
| IUPAC Name | [(3R,5S)-3,5-bis[(4,5-dimethoxypyrimidin-2-yl)oxymethyl]-4-[4-(3-phenylmethoxypropoxy)phenyl]piperidin-1-yl] tert-butyl carbonate |
| SMILES | COc1cnc(OC[C@@H]2CN(OC(=O)OC(C)(C)C)C[C@H](COc3ncc(OC)c(OC)n3)C2c2ccc(OCCCOCc3ccccc3)cc2)nc1OC |
| InChI | InChI=1S/C40H51N5O11/c1-40(2,3)55-39(46)56-45-22-29(25-53-37-41-20-32(47-4)35(43-37)49-6)34(30(23-45)26-54-38-42-21-33(48-5)36(44-38)50-7)28-14-16-31(17-15-28)52-19-11-18-51-24-27-12-9-8-10-13-27/h8-10,12-17,20-21,29-30,34H,11,18-19,22-26H2,1-7H3/t29-,30+,34? |
| InChIKey | PBSUOVWOTRLBNH-PXWABBFCSA-N |
| XLogP | 5.94 |
| TPSA | 164.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 777.87 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|