C17H13F5O2 — CID 54475708
[(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethyl] (2S)-2-phenylpropanoate (PubChem CID 54475708) has the molecular formula C17H13F5O2 and a molecular weight of 344.28 g/mol. Its IUPAC name is [(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethyl] (2S)-2-phenylpropanoate.
| Compound Name | [(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethyl] (2S)-2-phenylpropanoate |
|---|---|
| PubChem CID | 54475708 |
| Molecular Formula | C17H13F5O2 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | [(1S)-1-(2,3,4,5,6-pentafluorophenyl)ethyl] (2S)-2-phenylpropanoate |
| SMILES | C[C@H](OC(=O)[C@@H](C)c1ccccc1)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C17H13F5O2/c1-8(10-6-4-3-5-7-10)17(23)24-9(2)11-12(18)14(20)16(22)15(21)13(11)19/h3-9H,1-2H3/t8-,9-/m0/s1 |
| InChIKey | XLKUFZVRJAXXDE-IUCAKERBSA-N |
| XLogP | 4.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|