C20H24N4O4 — CID 54478750
5-[[3,5-diamino-4-(4-methoxyphenoxy)phenyl]methyl]-5-propylimidazolidine-2,4-dione (PubChem CID 54478750) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is 5-[[3,5-diamino-4-(4-methoxyphenoxy)phenyl]methyl]-5-propylimidazolidine-2,4-dione.
| Compound Name | 5-[[3,5-diamino-4-(4-methoxyphenoxy)phenyl]methyl]-5-propylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 54478750 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 5-[[3,5-diamino-4-(4-methoxyphenoxy)phenyl]methyl]-5-propylimidazolidine-2,4-dione |
| SMILES | CCCC1(Cc2cc(N)c(Oc3ccc(OC)cc3)c(N)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C20H24N4O4/c1-3-8-20(18(25)23-19(26)24-20)11-12-9-15(21)17(16(22)10-12)28-14-6-4-13(27-2)5-7-14/h4-7,9-10H,3,8,11,21-22H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | XNMLSBCPQONFTN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 128.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|