C20H33NO4 — CID 54480490
(1R,2R)-4,5,6-trimethoxy-2-(octylamino)-2,3-dihydro-1H-inden-1-ol (PubChem CID 54480490) has the molecular formula C20H33NO4 and a molecular weight of 351.49 g/mol. Its IUPAC name is (1R,2R)-4,5,6-trimethoxy-2-(octylamino)-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2R)-4,5,6-trimethoxy-2-(octylamino)-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 54480490 |
| Molecular Formula | C20H33NO4 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | (1R,2R)-4,5,6-trimethoxy-2-(octylamino)-2,3-dihydro-1H-inden-1-ol |
| SMILES | CCCCCCCCN[C@@H]1Cc2c(cc(OC)c(OC)c2OC)[C@H]1O |
| InChI | InChI=1S/C20H33NO4/c1-5-6-7-8-9-10-11-21-16-12-15-14(18(16)22)13-17(23-2)20(25-4)19(15)24-3/h13,16,18,21-22H,5-12H2,1-4H3/t16-,18-/m1/s1 |
| InChIKey | XOQNZZULQQMZND-SJLPKXTDSA-N |
| XLogP | 3.62 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|