C14H22NO5P — CID 54481294
butyl-(2-butyl-3-nitrophenoxy)phosphinic acid (PubChem CID 54481294) has the molecular formula C14H22NO5P and a molecular weight of 315.31 g/mol. Its IUPAC name is butyl-(2-butyl-3-nitrophenoxy)phosphinic acid.
| Compound Name | butyl-(2-butyl-3-nitrophenoxy)phosphinic acid |
|---|---|
| PubChem CID | 54481294 |
| Molecular Formula | C14H22NO5P |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | butyl-(2-butyl-3-nitrophenoxy)phosphinic acid |
| SMILES | CCCCc1c(OP(=O)(O)CCCC)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H22NO5P/c1-3-5-8-12-13(15(16)17)9-7-10-14(12)20-21(18,19)11-6-4-2/h7,9-10H,3-6,8,11H2,1-2H3,(H,18,19) |
| InChIKey | XPDXMFIGVPQBEH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|