C19H27NO4 — CID 54483322
2-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate (PubChem CID 54483322) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 2-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate.
| Compound Name | 2-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 54483322 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 2-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate |
| SMILES | Cc1c(C)c(O)n(CCC(=O)OC2C3CC4CC(C3)CC2C4)c1O |
| InChI | InChI=1S/C19H27NO4/c1-10-11(2)19(23)20(18(10)22)4-3-16(21)24-17-14-6-12-5-13(8-14)9-15(17)7-12/h12-15,17,22-23H,3-9H2,1-2H3 |
| InChIKey | XQOAGAJJAJRJNA-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |