C19H27NO4 — CID 91498371
1-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate (PubChem CID 91498371) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is 1-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate.
| Compound Name | 1-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate |
|---|---|
| PubChem CID | 91498371 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-adamantyl 3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoate |
| SMILES | Cc1c(C)c(O)n(CCC(=O)OC23CC4CC(CC(C4)C2)C3)c1O |
| InChI | InChI=1S/C19H27NO4/c1-11-12(2)18(23)20(17(11)22)4-3-16(21)24-19-8-13-5-14(9-19)7-15(6-13)10-19/h13-15,22-23H,3-10H2,1-2H3 |
| InChIKey | CRMHUTAGZHRYJE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |