C24H35NO7 — CID 91210156
1-ethoxyethyl 3-[3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoyloxy]adamantane-1-carboxylate (PubChem CID 91210156) has the molecular formula C24H35NO7 and a molecular weight of 449.54 g/mol. Its IUPAC name is 1-ethoxyethyl 3-[3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoyloxy]adamantane-1-carboxylate.
| Compound Name | 1-ethoxyethyl 3-[3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoyloxy]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 91210156 |
| Molecular Formula | C24H35NO7 |
| Molecular Weight | 449.54 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | 1-ethoxyethyl 3-[3-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)propanoyloxy]adamantane-1-carboxylate |
| SMILES | CCOC(C)OC(=O)C12CC3CC(CC(OC(=O)CCn4c(O)c(C)c(C)c4O)(C3)C1)C2 |
| InChI | InChI=1S/C24H35NO7/c1-5-30-16(4)31-22(29)23-9-17-8-18(10-23)12-24(11-17,13-23)32-19(26)6-7-25-20(27)14(2)15(3)21(25)28/h16-18,27-28H,5-13H2,1-4H3 |
| InChIKey | RPYKJUFSQVBSON-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.54 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|