C17H27NO5 — CID 90703204
1-ethoxyethyl 2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate (PubChem CID 90703204) has the molecular formula C17H27NO5 and a molecular weight of 325.41 g/mol. Its IUPAC name is 1-ethoxyethyl 2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate.
| Compound Name | 1-ethoxyethyl 2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 90703204 |
| Molecular Formula | C17H27NO5 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 1-ethoxyethyl 2-(2,5-dihydroxy-3,4-dimethylpyrrol-1-yl)cyclohexane-1-carboxylate |
| SMILES | CCOC(C)OC(=O)C1CCCCC1n1c(O)c(C)c(C)c1O |
| InChI | InChI=1S/C17H27NO5/c1-5-22-12(4)23-17(21)13-8-6-7-9-14(13)18-15(19)10(2)11(3)16(18)20/h12-14,19-20H,5-9H2,1-4H3 |
| InChIKey | RVDMHUVOYBMELC-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|