C18H27NO6 — CID 123862616
2-methylpropanoyloxymethyl 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 123862616) has the molecular formula C18H27NO6 and a molecular weight of 353.42 g/mol. Its IUPAC name is 2-methylpropanoyloxymethyl 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | 2-methylpropanoyloxymethyl 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 123862616 |
| Molecular Formula | C18H27NO6 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-methylpropanoyloxymethyl 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | Cc1cc(O)n(CC2CCC(C(=O)OCOC(=O)C(C)C)CC2)c1O |
| InChI | InChI=1S/C18H27NO6/c1-11(2)17(22)24-10-25-18(23)14-6-4-13(5-7-14)9-19-15(20)8-12(3)16(19)21/h8,11,13-14,20-21H,4-7,9-10H2,1-3H3 |
| InChIKey | DFSOIYJASZVDBK-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|