About 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate (PubChem CID 91154873) has the molecular formula C13H17NO6
and a molecular weight of 283.28 g/mol. Its IUPAC name is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate.
Analyze 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate?
The IUPAC name of 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate (CID 91154873) is 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate.
What is the SMILES notation for 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate?
The canonical SMILES for 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate is COC(=O)C1CCC(C(=O)On2c(O)ccc2O)CC1.
What is the InChIKey of 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate?
The InChIKey is RPXNSUOADGLGBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO6/c1-19-12(17)8-2-4-9(5-3-8)13(18)20-14-10(15)6-7-11(14)16/h6-9,15-16H,2-5H2,1H3.
What are the key properties of 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate?
4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate has a molecular weight of 283.28 g/mol, XLogP of 0.83, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-(2,5-dihydroxypyrrol-1-yl) 1-O-methyl cyclohexane-1,4-dicarboxylate is sourced from PubChem (CID 91154873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).