C12H11Br3ClFO2 — CID 54485733
2-(3-bromopropoxy)-1-chloro-5-(3,3-dibromoprop-2-enoxy)-3-fluorobenzene (PubChem CID 54485733) has the molecular formula C12H11Br3ClFO2 and a molecular weight of 481.38 g/mol. Its IUPAC name is 2-(3-bromopropoxy)-1-chloro-5-(3,3-dibromoprop-2-enoxy)-3-fluorobenzene.
| Compound Name | 2-(3-bromopropoxy)-1-chloro-5-(3,3-dibromoprop-2-enoxy)-3-fluorobenzene |
|---|---|
| PubChem CID | 54485733 |
| Molecular Formula | C12H11Br3ClFO2 |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 477.80 |
| IUPAC Name | 2-(3-bromopropoxy)-1-chloro-5-(3,3-dibromoprop-2-enoxy)-3-fluorobenzene |
| SMILES | Fc1cc(OCC=C(Br)Br)cc(Cl)c1OCCCBr |
| InChI | InChI=1S/C12H11Br3ClFO2/c13-3-1-4-19-12-9(16)6-8(7-10(12)17)18-5-2-11(14)15/h2,6-7H,1,3-5H2 |
| InChIKey | XSEFBFQBSTVSLN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|