C23H22ClN3O4 — CID 54488882
propan-2-yl 6-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 54488882) has the molecular formula C23H22ClN3O4 and a molecular weight of 439.90 g/mol. Its IUPAC name is propan-2-yl 6-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | propan-2-yl 6-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 54488882 |
| Molecular Formula | C23H22ClN3O4 |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.13 |
| IUPAC Name | propan-2-yl 6-(4-amino-2-chlorophenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COCc1c(C(=O)OC(C)C)ncc2[nH]c3ccc(Oc4ccc(N)cc4Cl)cc3c12 |
| InChI | InChI=1S/C23H22ClN3O4/c1-12(2)30-23(28)22-16(11-29-3)21-15-9-14(5-6-18(15)27-19(21)10-26-22)31-20-7-4-13(25)8-17(20)24/h4-10,12,27H,11,25H2,1-3H3 |
| InChIKey | XUIJJJMEFPXWLE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|