About 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole
6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole (PubChem CID 56609104) has the molecular formula C20H16Cl2N2O2
and a molecular weight of 387.27 g/mol. Its IUPAC name is 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole.
Molecular Properties
| Compound Name | 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole |
| PubChem CID | 56609104 |
| Molecular Formula | C20H16Cl2N2O2 |
| Molecular Weight | 387.27 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole |
| SMILES | COCc1c(C)ncc2[nH]c3ccc(Oc4ccc(Cl)cc4Cl)cc3c12 |
| InChI | InChI=1S/C20H16Cl2N2O2/c1-11-15(10-25-2)20-14-8-13(4-5-17(14)24-18(20)9-23-11)26-19-6-3-12(21)7-16(19)22/h3-9,24H,10H2,1-2H3 |
| InChIKey | BMJOWLLUSDMXET-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.27 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole?
The IUPAC name of 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole (CID 56609104) is 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole.
What is the SMILES notation for 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole?
The canonical SMILES for 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole is COCc1c(C)ncc2[nH]c3ccc(Oc4ccc(Cl)cc4Cl)cc3c12.
What is the InChIKey of 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole?
The InChIKey is BMJOWLLUSDMXET-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16Cl2N2O2/c1-11-15(10-25-2)20-14-8-13(4-5-17(14)24-18(20)9-23-11)26-19-6-3-12(21)7-16(19)22/h3-9,24H,10H2,1-2H3.
What are the key properties of 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole?
6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole has a molecular weight of 387.27 g/mol, XLogP of 6.27, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,4-dichlorophenoxy)-4-(methoxymethyl)-3-methyl-9H-pyrido[3,4-b]indole is sourced from PubChem (CID 56609104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).