C23H21N3O7 — CID 67870868
ethyl [4-(methoxymethyl)-6-(2-methyl-4-nitrophenoxy)-9H-pyrido[3,4-b]indol-3-yl] carbonate (PubChem CID 67870868) has the molecular formula C23H21N3O7 and a molecular weight of 451.44 g/mol. Its IUPAC name is ethyl [4-(methoxymethyl)-6-(2-methyl-4-nitrophenoxy)-9H-pyrido[3,4-b]indol-3-yl] carbonate.
| Compound Name | ethyl [4-(methoxymethyl)-6-(2-methyl-4-nitrophenoxy)-9H-pyrido[3,4-b]indol-3-yl] carbonate |
|---|---|
| PubChem CID | 67870868 |
| Molecular Formula | C23H21N3O7 |
| Molecular Weight | 451.44 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | ethyl [4-(methoxymethyl)-6-(2-methyl-4-nitrophenoxy)-9H-pyrido[3,4-b]indol-3-yl] carbonate |
| SMILES | CCOC(=O)Oc1ncc2[nH]c3ccc(Oc4ccc([N+](=O)[O-])cc4C)cc3c2c1COC |
| InChI | InChI=1S/C23H21N3O7/c1-4-31-23(27)33-22-17(12-30-3)21-16-10-15(6-7-18(16)25-19(21)11-24-22)32-20-8-5-14(26(28)29)9-13(20)2/h5-11,25H,4,12H2,1-3H3 |
| InChIKey | XNBCCGKVIPOWOF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 125.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.44 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|