About [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate
[6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (PubChem CID 67871441) has the molecular formula C25H24N2O6
and a molecular weight of 448.48 g/mol. Its IUPAC name is [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
Molecular Properties
| Compound Name | [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| PubChem CID | 67871441 |
| Molecular Formula | C25H24N2O6 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate |
| SMILES | COCc1c(OC(=O)OC(C)C)ncc2[nH]c3ccc(Oc4ccccc4C(C)=O)cc3c12 |
| InChI | InChI=1S/C25H24N2O6/c1-14(2)31-25(29)33-24-19(13-30-4)23-18-11-16(9-10-20(18)27-21(23)12-26-24)32-22-8-6-5-7-17(22)15(3)28/h5-12,14,27H,13H2,1-4H3 |
| InChIKey | BYPFPBSLZNXAJM-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The IUPAC name of [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate (CID 67871441) is [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate.
What is the SMILES notation for [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The canonical SMILES for [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is COCc1c(OC(=O)OC(C)C)ncc2[nH]c3ccc(Oc4ccccc4C(C)=O)cc3c12.
What is the InChIKey of [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
The InChIKey is BYPFPBSLZNXAJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24N2O6/c1-14(2)31-25(29)33-24-19(13-30-4)23-18-11-16(9-10-20(18)27-21(23)12-26-24)32-22-8-6-5-7-17(22)15(3)28/h5-12,14,27H,13H2,1-4H3.
What are the key properties of [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate?
[6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate has a molecular weight of 448.48 g/mol, XLogP of 5.78, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-acetylphenoxy)-4-(methoxymethyl)-9H-pyrido[3,4-b]indol-3-yl] propan-2-yl carbonate is sourced from PubChem (CID 67871441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).