C11H21O7P — CID 54489105
[1-(2,2-diethoxyethoxy)-3-methyl-1-oxobut-2-en-2-yl]phosphonic acid (PubChem CID 54489105) has the molecular formula C11H21O7P and a molecular weight of 296.26 g/mol. Its IUPAC name is [1-(2,2-diethoxyethoxy)-3-methyl-1-oxobut-2-en-2-yl]phosphonic acid.
| Compound Name | [1-(2,2-diethoxyethoxy)-3-methyl-1-oxobut-2-en-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 54489105 |
| Molecular Formula | C11H21O7P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | [1-(2,2-diethoxyethoxy)-3-methyl-1-oxobut-2-en-2-yl]phosphonic acid |
| SMILES | CCOC(COC(=O)C(=C(C)C)P(=O)(O)O)OCC |
| InChI | InChI=1S/C11H21O7P/c1-5-16-9(17-6-2)7-18-11(12)10(8(3)4)19(13,14)15/h9H,5-7H2,1-4H3,(H2,13,14,15) |
| InChIKey | XULWVSLBRMBORS-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|