C14H26FO9P — CID 122453772
[(2R)-2-[(1S,2S)-1-acetyloxy-2-fluoropropoxy]-2-(diethoxyphosphorylmethoxy)ethyl] acetate (PubChem CID 122453772) has the molecular formula C14H26FO9P and a molecular weight of 388.33 g/mol. Its IUPAC name is [(2R)-2-[(1S,2S)-1-acetyloxy-2-fluoropropoxy]-2-(diethoxyphosphorylmethoxy)ethyl] acetate.
| Compound Name | [(2R)-2-[(1S,2S)-1-acetyloxy-2-fluoropropoxy]-2-(diethoxyphosphorylmethoxy)ethyl] acetate |
|---|---|
| PubChem CID | 122453772 |
| Molecular Formula | C14H26FO9P |
| Molecular Weight | 388.33 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [(2R)-2-[(1S,2S)-1-acetyloxy-2-fluoropropoxy]-2-(diethoxyphosphorylmethoxy)ethyl] acetate |
| SMILES | CCOP(=O)(CO[C@H](COC(C)=O)O[C@@H](OC(C)=O)[C@H](C)F)OCC |
| InChI | InChI=1S/C14H26FO9P/c1-6-21-25(18,22-7-2)9-20-13(8-19-11(4)16)24-14(10(3)15)23-12(5)17/h10,13-14H,6-9H2,1-5H3/t10-,13-,14+/m0/s1 |
| InChIKey | WAINPOVVPZRVSR-LEWSCRJBSA-N |
| XLogP | 2.38 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|