C23H32N4O5S — CID 54489615
(2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 54489615) has the molecular formula C23H32N4O5S and a molecular weight of 476.60 g/mol. Its IUPAC name is (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 54489615 |
| Molecular Formula | C23H32N4O5S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | (2S)-2-[[2-[[(5S)-7-(2,5-dihydroxypyrrol-1-yl)-4-oxo-5-sulfanylheptyl]amino]acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | CNC(=O)[C@H](Cc1ccccc1)NC(=O)CNCCCC(=O)[C@@H](S)CCn1c(O)ccc1O |
| InChI | InChI=1S/C23H32N4O5S/c1-24-23(32)17(14-16-6-3-2-4-7-16)26-20(29)15-25-12-5-8-18(28)19(33)11-13-27-21(30)9-10-22(27)31/h2-4,6-7,9-10,17,19,25,30-31,33H,5,8,11-15H2,1H3,(H,24,32)(H,26,29)/t17-,19-/m0/s1 |
| InChIKey | JLPGLDABUBMSHU-HKUYNNGSSA-N |
| XLogP | 1.00 |
| TPSA | 132.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|