C23H27N3O4 — CID 54489859
N-[(2R,4S)-1-(3,5-dimethylbenzoyl)-2-[(4-nitrophenyl)methyl]piperidin-4-yl]acetamide (PubChem CID 54489859) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[(2R,4S)-1-(3,5-dimethylbenzoyl)-2-[(4-nitrophenyl)methyl]piperidin-4-yl]acetamide.
| Compound Name | N-[(2R,4S)-1-(3,5-dimethylbenzoyl)-2-[(4-nitrophenyl)methyl]piperidin-4-yl]acetamide |
|---|---|
| PubChem CID | 54489859 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | N-[(2R,4S)-1-(3,5-dimethylbenzoyl)-2-[(4-nitrophenyl)methyl]piperidin-4-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CCN(C(=O)c2cc(C)cc(C)c2)[C@H](Cc2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C23H27N3O4/c1-15-10-16(2)12-19(11-15)23(28)25-9-8-20(24-17(3)27)14-22(25)13-18-4-6-21(7-5-18)26(29)30/h4-7,10-12,20,22H,8-9,13-14H2,1-3H3,(H,24,27)/t20-,22+/m0/s1 |
| InChIKey | XUYGMULFOPVFHB-RBBKRZOGSA-N |
| XLogP | 3.56 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|