C33H40N4O2 — CID 86756202
2-amino-N-[1-[(2S,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]piperidin-4-yl]benzamide (PubChem CID 86756202) has the molecular formula C33H40N4O2 and a molecular weight of 524.71 g/mol. Its IUPAC name is 2-amino-N-[1-[(2S,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]piperidin-4-yl]benzamide.
| Compound Name | 2-amino-N-[1-[(2S,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 86756202 |
| Molecular Formula | C33H40N4O2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.32 |
| IUPAC Name | 2-amino-N-[1-[(2S,4S)-2-benzyl-1-(3,5-dimethylbenzoyl)piperidin-4-yl]piperidin-4-yl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)N2CC[C@H](N3CCC(NC(=O)c4ccccc4N)CC3)C[C@@H]2Cc2ccccc2)c1 |
| InChI | InChI=1S/C33H40N4O2/c1-23-18-24(2)20-26(19-23)33(39)37-17-14-28(22-29(37)21-25-8-4-3-5-9-25)36-15-12-27(13-16-36)35-32(38)30-10-6-7-11-31(30)34/h3-11,18-20,27-29H,12-17,21-22,34H2,1-2H3,(H,35,38)/t28-,29-/m0/s1 |
| InChIKey | DVLHRHQXZZKXCH-VMPREFPWSA-N |
| XLogP | 5.00 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|